1158-17-4,o-Nitrophenylsulfenyl-1-thio-beta-D-galactoside,
CAS:1158-17-4
C12H15NO7S / 317.32
MFCD00076099
2-Nitrophenyl-beta-D-thiogalactopyranoside is a chromogenic substrate used to detect the presence of galactosidase enzymes in various biological and biochemical assays. It consists of a nitrophenyl group attached to a galactose sugar molecule through a thioglycosidic bond. When acted upon by enzymes such as galactosidases, it releases the colored nitrophenyl group, which can be detected using spectrophotometry. This substrate is commonly used in assays for the detection of LacZ activity in bacterial cultures, as lacZ encodes for beta-galactosidase.
| CAS Number | 1158-17-4 |
| Product Name | (2r,3r,4s,5r,6s)-2-(Hydroxymethyl)-6-(2-Nitrophenyl)sulfanyl-Oxane-3,4,5-Triol |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenyl)sulfanyloxane-3,4,5-triol |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| InChI | InChI=1S/C12H15NO7S/c14-5-7-9(15)10(16)11(17)12(20-7)21-8-4-2-1-3-6(8)13(18)19/h1-4,7,9-12,14-17H,5H2/t7-,9+,10+,11-,12+/m1/s1 |
| InChI Key | SZAOZNVCHHBUDZ-RUXWNWLUSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])SC2C(C(C(C(O2)CO)O)O)O |
| Synonyms | o-nitrophenol beta-thiogalactoside |
| Canonical SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])SC2C(C(C(C(O2)CO)O)O)O |
| Isomeric SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
CAS No: 1158-17-4 Synonyms: ONP-1-thio-b-D-Gal MDL No: MFCD00076099 Chemical Formula: C12H15NO7S Molecular Weight: 317.32 |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628