24259-59-4 ,L-Ribose, CAS:24259-59-4
C5H10O5 / 150.13
MFCD00167010
It is produced by microorganism fermentation of glucose in a fermentation culture medium without adding calcium carbonate.
Aldehydo-L-ribose is a L-ribose and an aldehydo-ribose. It is an enantiomer of an aldehydo-D-ribose.
| CAS Number | 24259-59-4 |
| Product Name | L-Ribose |
| IUPAC Name | (2S,3S,4S)-2,3,4,5-tetrahydroxypentanal |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m1/s1 |
| InChI Key | PYMYPHUHKUWMLA-MROZADKFSA-N |
| SMILES | C(C(C(C(C=O)O)O)O)O |
| Synonyms | L-(+)-Ribose; |
| Canonical SMILES | C(C(C(C(C=O)O)O)O)O |
| Isomeric SMILES | C([C@@H]([C@@H]([C@@H](C=O)O)O)O)O |
| CAS No: 24259-59-4 MDL No: MFCD00167010 Chemical Formula: C5H10O5 Molecular Weight: 150.13 |
| References: 1. Ahmed Z, Shimonishi T, Bhuiyan H, Utamura M, Takada G, Izumori K, J. Biosci. Bioeng. 1999, 88, 444-4482. Beil. 1, IV, 4214 |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628