25997-59-5 ,6-Bromo-2-naphthyl a-D-galactopyranoside, CAS:25997-59-5
C16H17BrO6 / 385.21
MFCD00066434
6-溴-2-萘基-a-D-半乳糖苷
6-Bromo-2-naphthyl-alpha-D-galactopyranoside is a chromogenic substrate used in enzyme assays to detect and measure the activity of enzymes that act on alpha-galactosides. It is a type of glycoside inhibitor of α-galactosidase and other glycosidases that hydrolyze galactose and other sugar derivatives. The product is used to study the changes in enzyme activity over time or in response to different conditions.
| CAS Number | 25997-59-5 |
| Product Name | 6-Bromo-2-naphthyl-alpha-D-galactopyranoside |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(6-bromonaphthalen-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C16H17BrO6 |
| Molecular Weight | 385.21 g/mol |
| InChI | InChI=1S/C16H17BrO6/c17-10-3-1-9-6-11(4-2-8(9)5-10)22-16-15(21)14(20)13(19)12(7-18)23-16/h1-6,12-16,18-21H,7H2/t12-,13+,14+,15-,16+/m1/s1 |
| InChI Key | NLRXQZJJCPRATR-CWVYHPPDSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1OC3C(C(C(C(O3)CO)O)O)O |
| Canonical SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1OC3C(C(C(C(O3)CO)O)O)O |
| Isomeric SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1O[C@@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O |
CAS No: 25997-59-5 Synonyms: 2-(6-Bromonaphthyl)-a-D-galactopyranosideBr-nap-a-D-gal MDL No: MFCD00066434 Chemical Formula: C16H17BrO6 Molecular Weight: 385.21 | |
| References: 1. Tsou KC, Su HCF,, Anal. Biochem. 1964, 8, p415 | |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628