383160-15-4 , Fuc-a-1,4-Gal-b-MU;
4-Methylumbelliferyl 4-O-(a-L-fucopyranosyl)-b-D-galactopyranoside
C22H28O12 / 484.45
MFCD01320429
4-Methylumbelliferyl 4-O-(a-L-fucopyranosyl)-b-D-galactopyranoside
The 4-methylumbelliferyl 4-O-(α-L-fucopyranosyl)-β-D-galactopyranoside is a fluorescent compound that can be used as an antigen. It can be used to generate antibodies against the antigen, which are then used for diagnosis of cancer. The nucleic acid molecules and sequences encoding this antigen can also be used in diagnostics.
| CAS Number | 383160-15-4 |
| Product Name | Fuc1-alpha-4Gal1-b-4-MU |
| IUPAC Name | 7-[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-4-methylchromen-2-one |
| Molecular Formula | C₂₂H₂₈O₁₂ |
| Molecular Weight | 484.4 g/mol |
| InChI | InChI=1S/C22H28O12/c1-8-5-14(24)32-12-6-10(3-4-11(8)12)31-22-19(29)17(27)20(13(7-23)33-22)34-21-18(28)16(26)15(25)9(2)30-21/h3-6,9,13,15-23,25-29H,7H2,1-2H3 |
| InChI Key | UAKRUHKRXFCMAA-UHFFFAOYSA-N |
| SMILES | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3=CC4=C(C=C3)C(=CC(=O)O4)C)CO)O)O)O |
| Synonyms | Fuc1-α-4Gal1-b-4-MU |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3=CC4=C(C=C3)C(=CC(=O)O4)C)CO)O)O)O |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628