508220-80-2 , 4-Nitrophenyl 2-O-trans-feruloyl-a-L-arabinofuranoside,
Cas:508220-80-2
C21H21NO10 / 447.39
4-Nitrophenyl 2-O-trans-feruloyl-a-L-arabinofuranoside is a chemiluminescent substrate that is used to detect the presence of hydrogen peroxide in biological samples. It is an oxidized form of 4-nitrophenol and has been shown to have a high affinity for the enzyme horseradish peroxidase. This product can be used to determine the presence of bacteria in culture media, food, or water. The reaction between this product and hydrogen peroxide produces light that can be detected using a luminometer. 4NPFAF has also been used as a ligand in receptor binding studies and as a fluorescent marker for DNA sequencing.
| CAS Number | 508220-80-2 |
| Product Name | (2S,3R,4S,5S)-4-Hydroxy-5-(hydroxymethyl)-2-(4-nitrophenoxy)tetrahydrofuran-3-yl (E)-3-(4-hydroxy-3-methoxyphenyl)acrylate |
| IUPAC Name | [(2S,3R,4S,5S)-4-hydroxy-5-(hydroxymethyl)-2-(4-nitrophenoxy)oxolan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Molecular Formula | C21H21NO10 |
| Molecular Weight | 447.4 g/mol |
| InChI | InChI=1S/C21H21NO10/c1-29-16-10-12(2-8-15(16)24)3-9-18(25)32-20-19(26)17(11-23)31-21(20)30-14-6-4-13(5-7-14)22(27)28/h2-10,17,19-21,23-24,26H,11H2,1H3/b9-3+/t17-,19-,20+,21+/m0/s1 |
| InChI Key | XHPDERUPTDOZON-LUIQYSJNSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)OC2C(C(OC2OC3=CC=C(C=C3)[N+](=O)[O-])CO)O)O |
| Canonical SMILES | COC1=C(C=CC(=C1)C=CC(=O)OC2C(C(OC2OC3=CC=C(C=C3)[N+](=O)[O-])CO)O)O |
| Isomeric SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)O[C@@H]2[C@H]([C@@H](O[C@H]2OC3=CC=C(C=C3)[N+](=O)[O-])CO)O)O |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628