Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

53008-65-4 ,Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside, CAS:53008-65-4

53008-65-4 ,Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside,
CAS:53008-65-4
C28H32O6 / 464.55
MFCD06798958

Methyl 2,3,4-tri-O-benzyl-a-D-glucopyranoside

甲基-2,3,4-三-O-苄基-alpha-D-吡喃葡萄糖苷

Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside: Definition and Background

Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside is a white crystalline powder with a sweet taste. This chemical compound is widely used in the pharmaceutical industry due to its superior physical and chemical properties. It is a derivative of glucose, typically derived from the reaction of benzyl alcohol with methyl glucoside in the presence of an acid catalyst. The resulting compound is used in scientific experiments and research.

Synthesis and Characterization

The synthesis of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside involves the reaction of methyl glucoside and benzyl alcohol in the presence of an acid catalyst. The synthesis reaction leads to the formation of a white crystalline powder, which is then purified by recrystallization. The resulting compound is characterized using various analytical techniques such as nuclear magnetic resonance spectroscopy, mass spectroscopy, and infrared spectroscopy.

Analytical Methods

Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside can be analyzed using various techniques such as gas chromatography (GC), high-performance liquid chromatography (HPLC), and mass spectroscopy (MS). These analytical methods are used to determine the purity of the compound and to identify its impurities.

Biological Properties

Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside has been reported to exhibit various biological activities such as antitumor, anti-inflammatory, and antibacterial properties. The compound has been shown to inhibit the growth of cancer cells and reduce inflammation. Further research is needed to fully understand the biological activity of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside.

Toxicity and Safety in Scientific Experiments

Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside has been shown to have low toxicity in scientific experiments. However, caution should be taken when handling the compound, as it can cause irritation to the skin and eyes. Proper safety precautions should be taken when working with this chemical compound.

Applications in Scientific Experiments

Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside has various applications in scientific experiments such as drug delivery systems, cell culture, and synthesis of other compounds. The compound is widely used in the pharmaceutical industry due to its superior properties.

Current State of Research

Recent research has focused on the synthesis of new derivatives of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside and their biological activities. There is also ongoing research on the potential applications of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside in drug delivery systems.

Potential Implications in Various Fields of Research and Industry

Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside has the potential to be used in various fields of research and industry such as pharmaceuticals, biotechnology, and nanotechnology. The compound could be used to develop new drugs and drug delivery systems.

Limitations and Future Directions

One of the main limitations of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside is its limited solubility in water and organic solvents. Future research should focus on developing more soluble derivatives of the compound. Additionally, further research is needed to fully understand the biological activity of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside and its potential applications in various fields of research and industry.

Future Directions

1. Synthesis of more soluble derivatives of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside

2. Investigation of the potential applications of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside in nanotechnology

3. Optimization of the synthesis reaction to improve the yield of the compound

4. Investigation of the potential biological activities of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside in different cell lines

5. Development of new drug delivery systems using Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside

6. Study of the pharmacokinetics of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside in vivo

7. Investigation of the potential applications of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside in the treatment of bacterial infections

8. Development of a more efficient purification process for Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside

9. Study of the potential toxicity of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside in different animal models

10. Investigation of the potential applications of Methyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside in the synthesis of other compounds.

CAS Number53008-65-4
Product NameMethyl 2,3,4-Tri-O-benzyl-alpha-D-glucopyranoside
IUPAC Name[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol
Molecular FormulaC28H32O6
Molecular Weight464.55 g/mol
InChIInChI=1S/C28H32O6/c1-30-28-27(33-20-23-15-9-4-10-16-23)26(32-19-22-13-7-3-8-14-22)25(24(17-29)34-28)31-18-21-11-5-2-6-12-21/h2-16,24-29H,17-20H2,1H3/t24-,25-,26+,27-,28+/m1/s1
InChI KeyMOKYEUQDXDKNDX-DFLSAPQXSA-N
SMILESCOC1C(C(C(C(O1)CO)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4
SynonymsMethyl 2,3,4-Tri-O-phenylmethyl-α-D-glucopyranoside
Canonical SMILESCOC1C(C(C(C(O1)CO)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4
Isomeric SMILESCO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4
CAS No: 53008-65-4 MDL No: MFCD06798958 Chemical Formula: C28H32O6 Molecular Weight: 464.55
References: 1. Robertson AAB, Botting NP,, J. Labelled Comp. Radiopharm., 2006, 49, 13, p1201


INQUIRY

Scan the qr codeClose
the qr code