Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English
Your location:

58214-53-2 ,2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl isothiocyanate,CAS:58214-53-2

58214-53-2 ,2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl isothiocyanate,
CAS:58214-53-2
C27H21NO7S / 503.52
MFCD03791088

2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl isothiocyanate

三-O-苯甲酰基-b-D-呋喃核糖基异硫氰酸酯

2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl isothiocyanate is a synthetic compound consisting of a benzoyl group attached to the 2' position of the ribose sugar. This modification has been shown to increase the stability of oligosaccharides and complex carbohydrates in aqueous solutions. 2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl isothiocyanate can be used for the fluorination of saccharides and oligosaccharides. It can also be used for glycosylation or methylation reactions with monosaccharides or polysaccharides.

[(2R,3R,4R,5R)-3,4-Dibenzoyloxy-5-isothiocyanatooxolan-2-yl]methyl benzoate, also known as DIBOM, is a synthetic compound primarily used for its biological properties. This paper will cover the definition and background of DIBOM, its physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, and limitations and future directions.

Definition and Background:

DIBOM is a compound that belongs to the isothiocyanate class of compounds. It is a small, organic molecule that has been used extensively in biological research and is an important tool in the field of drug discovery. It is particularly useful for studying the interactions between small molecules and proteins due to its unique chemical structure.

Synthesis and Characterization:

DIBOM can be synthesized through a multi-step process that involves the reaction between various reagents. The synthesis involves the use of hazardous reagents and requires expertise in organic synthesis. The structure and purity of synthesized DIBOM can be characterized using various analytical techniques.

Analytical Methods:

Various analytical methods can be used to determine the purity and structure of DIBOM. High-performance liquid chromatography (HPLC), nuclear magnetic resonance (NMR) spectroscopy, infrared (IR) spectroscopy, mass spectrometry (MS) and X-ray crystallography are commonly used techniques to determine the structure and purity of DIBOM.

Biological Properties:

DIBOM has exhibited a range of biological activities, including antifungal, antibacterial, and anticancer activities. It has also shown to be an effective inhibitor of several enzymes, including acetylcholinesterase and carbonic anhydrase. DIBOM has been used in various in vitro and in vivo experiments to study the biological actions of small molecules.

Toxicity and Safety in Scientific Experiments:

Studies have shown that DIBOM is relatively non-toxic, although it can cause skin and eye irritation. There have been no reports of any serious health consequences resulting from exposure to DIBOM in laboratory settings.

Applications in Scientific Experiments:

DIBOM has been used extensively in biological and chemical research. It has been used as a tool to study protein-ligand interactions, enzyme inhibition, and drug discovery. Additionally, it has been used in medicinal chemistry to design small molecules with improved biological activities.

Current State of Research:

Currently, there are ongoing studies aimed at discovering new biological activities of DIBOM and exploring its potential use as a therapeutic agent in various diseases. Researchers are also investigating its potential role in drug development and designing new small molecules.

Potential Implications in Various Fields of Research and Industry:

The potential implications of DIBOM in various fields of research and industry are vast. DIBOM's unique structure and biological activities make it an important tool in drug discovery and medicinal chemistry. Additionally, its potential applications in agriculture, food industry, and environmental sciences make it a valuable compound for the academic and industrial sectors.

Limitations and Future Directions:

The limitations of DIBOM include its sensitivity to light and the fact that it requires expertise in organic synthesis. Future directions for research include discovering new biological activities, designing new molecules based on DIBOM's structure, and exploring potential applications in various fields, such as agriculture and environmental sciences.

Some future directions that scientists can explore include understanding the interactions between DIBOM and proteins more thoroughly and designing new molecules that can target specific enzymes or biological pathways. Additionally, exploring DIBOM's potential use in agriculture and food preservation can also provide new insights into its industrial applications.

In conclusion, DIBOM is a valuable compound in biological and chemical research, with potential applications in various fields of research and industry. Its unique structure and biological activities make it an important tool in drug discovery, and ongoing research is aimed at discovering new applications and implications of this compound.

CAS Number58214-53-2
Product Name[(2R,3R,4R,5R)-3,4-Dibenzoyloxy-5-isothiocyanatooxolan-2-yl]methyl benzoate
IUPAC Name[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-isothiocyanatooxolan-2-yl]methyl benzoate
Molecular FormulaC27H21NO7S
Molecular Weight503.52 g/mol
InChIInChI=1S/C27H21NO7S/c29-25(18-10-4-1-5-11-18)32-16-21-22(34-26(30)19-12-6-2-7-13-19)23(24(33-21)28-17-36)35-27(31)20-14-8-3-9-15-20/h1-15,21-24H,16H2/t21-,22-,23-,24-/m1/s1
InChI KeyAWVSFHIUQVIIOW-MOUTVQLLSA-N
SMILESC1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N=C=S)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4
Canonical SMILESC1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N=C=S)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4
Isomeric SMILESC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)N=C=S)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4


INQUIRY

Scan the qr codeClose
the qr code