7660-25-5, b-D-Fructopyranose, CAS:7660-25-5
C6H12O6 / 180.16
Fructose is a monosaccharide that can be found in many fruits, honey, and some vegetables. It has been shown to have pathogenic effects on the kidney by causing tubulointerstitial injury. This damage may be due to the degradation of fructose by sorbitol dehydrogenase into hydrogen fluoride, which inhibits cell respiration and increases oxidative stress. Fructose also binds to bcl-2 protein and glycol ethers, which may lead to apoptosis.
D-fructopyranose is a fructopyranose having D-configuration. It has a role as a sweetening agent. It is a fructopyranose, a D-fructose and a cyclic hemiketal.
A monosaccharide in sweet fruits and honey that is soluble in water, alcohol, or ether. It is used as a preservative and an intravenous infusion in parenteral feeding.
| CAS Number | 7660-25-5 |
| Product Name | Fructose |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| Molecular Formula | C₆H₁₂O₆ |
| Molecular Weight | 180.16 g/mol |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5+,6-/m1/s1 |
| InChI Key | LKDRXBCSQODPBY-ARQDHWQXSA-N |
| SMILES | C1C(C(C(C(O1)(CO)O)O)O)O |
| Solubility | Solubility in water at 20 °C: good |
| Synonyms | Apir Levulosa, Fleboplast Levulosa, Fructose, Levulosa, Levulosa Baxter, Levulosa Braun, Levulosa Grifols, Levulosa Ibys, Levulosa Ife, Levulosa Mein, Levulosa, Apir, Levulosa, Fleboplast, Levulosado Bieffe Medit, Levulosado Braun, Levulosado Vitulia, Levulose, Plast Apyr Levulosa Mein |
| Canonical SMILES | C1C(C(C(C(O1)(CO)O)O)O)O |
| Isomeric SMILES | C1[C@H]([C@H]([C@@H]([C@](O1)(CO)O)O)O)O |
We can also supply similar following products.
| D-Psicose or D-Allulose | CAS: | 551-68-8,23140-52-5 |
| D-Fructose | CAS: | 57-48-7 |
| a-D-Fructopyranose | CAS: | 10489-81-3 |
| b-D-Fructopyranose | CAS: | 7660-25-5 |
| a-D-Fructofuranose | CAS: | 10489-79-9 |
| b-D-Fructofuranose | CAS: | 470-23-5 |
| L-Fructose | CAS: | 7776-48-9 |
| L-Sorbose | CAS: | 87-79-6 |
| D-Sorbose | CAS: | 3615-56-3 |
| D-Xylulose | CAS: | 551-84-8 |
| L-Xylulose | CAS: | 527-50-4 |
| 3-Deoxy-D-glucosone | CAS: | 4084-27-9 |
| D-Erythrulose | CAS: | 496-55-9 |
| D-Threose | CAS: | 533-50-6 |
| 1-Deoxy-D-ribulose | CAS: | |
| 1-Deoxy-D-xylulose | CAS: | 60299-43-6 |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628